C19H16N4O4 — CID 55813649
N-[4-(cyanomethoxy)phenyl]-3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxamide (PubChem CID 55813649) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is N-[4-(cyanomethoxy)phenyl]-3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxamide.
| Compound Name | N-[4-(cyanomethoxy)phenyl]-3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 55813649 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[4-(cyanomethoxy)phenyl]-3-ethyl-2,4-dioxo-1H-quinazoline-7-carboxamide |
| SMILES | CCn1c(=O)[nH]c2cc(C(=O)Nc3ccc(OCC#N)cc3)ccc2c1=O |
| InChI | InChI=1S/C19H16N4O4/c1-2-23-18(25)15-8-3-12(11-16(15)22-19(23)26)17(24)21-13-4-6-14(7-5-13)27-10-9-20/h3-8,11H,2,10H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | OKMURVYCTIMWAD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |