C20H21N3O5S — CID 55814263
3-[4-(methylsulfamoyl)phenyl]-N-[[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]prop-2-enamide (PubChem CID 55814263) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is 3-[4-(methylsulfamoyl)phenyl]-N-[[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | 3-[4-(methylsulfamoyl)phenyl]-N-[[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55814263 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 3-[4-(methylsulfamoyl)phenyl]-N-[[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]methyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)c1ccc(C=CC(=O)NCc2cccc(N3CCOC3=O)c2)cc1 |
| InChI | InChI=1S/C20H21N3O5S/c1-21-29(26,27)18-8-5-15(6-9-18)7-10-19(24)22-14-16-3-2-4-17(13-16)23-11-12-28-20(23)25/h2-10,13,21H,11-12,14H2,1H3,(H,22,24) |
| InChIKey | PIRZAWXUVAXLAO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|