C26H28N4O3S — CID 55814441
N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-4-[(2-methylphenyl)sulfamoyl]benzamide (PubChem CID 55814441) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-4-[(2-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-4-[(2-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 55814441 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-4-[(2-methylphenyl)sulfamoyl]benzamide |
| SMILES | CCC(C)C(NC(=O)c1ccc(S(=O)(=O)Nc2ccccc2C)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H28N4O3S/c1-4-17(2)24(25-27-22-11-7-8-12-23(22)28-25)29-26(31)19-13-15-20(16-14-19)34(32,33)30-21-10-6-5-9-18(21)3/h5-17,24,30H,4H2,1-3H3,(H,27,28)(H,29,31) |
| InChIKey | OJSBOZHOFPMYRD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |