C18H20N4O2 — CID 94613930
N-[(1S,2R)-1-(1H-benzimidazol-2-yl)-2-methylbutyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 94613930) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[(1S,2R)-1-(1H-benzimidazol-2-yl)-2-methylbutyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[(1S,2R)-1-(1H-benzimidazol-2-yl)-2-methylbutyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 94613930 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[(1S,2R)-1-(1H-benzimidazol-2-yl)-2-methylbutyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)c1cc[n+]([O-])cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H20N4O2/c1-3-12(2)16(17-19-14-6-4-5-7-15(14)20-17)21-18(23)13-8-10-22(24)11-9-13/h4-12,16H,3H2,1-2H3,(H,19,20)(H,21,23)/t12-,16+/m1/s1 |
| InChIKey | XXRCNBFIEUBUKH-WBMJQRKESA-N |
| XLogP | 2.71 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|