C19H28N4O2 — CID 51091867
N-[2-[[1-(1H-benzimidazol-2-yl)-2-methylbutyl]amino]-2-oxoethyl]-2-methylbutanamide (PubChem CID 51091867) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[2-[[1-(1H-benzimidazol-2-yl)-2-methylbutyl]amino]-2-oxoethyl]-2-methylbutanamide.
| Compound Name | N-[2-[[1-(1H-benzimidazol-2-yl)-2-methylbutyl]amino]-2-oxoethyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 51091867 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N-[2-[[1-(1H-benzimidazol-2-yl)-2-methylbutyl]amino]-2-oxoethyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NCC(=O)NC(c1nc2ccccc2[nH]1)C(C)CC |
| InChI | InChI=1S/C19H28N4O2/c1-5-12(3)17(18-21-14-9-7-8-10-15(14)22-18)23-16(24)11-20-19(25)13(4)6-2/h7-10,12-13,17H,5-6,11H2,1-4H3,(H,20,25)(H,21,22)(H,23,24) |
| InChIKey | HUGNWMRXMYQMAD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |