C16H20N4OS — CID 94613958
N-[(1S,2R)-1-(1H-benzimidazol-2-yl)-2-methylbutyl]-2-(cyanomethylsulfanyl)acetamide (PubChem CID 94613958) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[(1S,2R)-1-(1H-benzimidazol-2-yl)-2-methylbutyl]-2-(cyanomethylsulfanyl)acetamide.
| Compound Name | N-[(1S,2R)-1-(1H-benzimidazol-2-yl)-2-methylbutyl]-2-(cyanomethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 94613958 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-[(1S,2R)-1-(1H-benzimidazol-2-yl)-2-methylbutyl]-2-(cyanomethylsulfanyl)acetamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)CSCC#N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H20N4OS/c1-3-11(2)15(20-14(21)10-22-9-8-17)16-18-12-6-4-5-7-13(12)19-16/h4-7,11,15H,3,9-10H2,1-2H3,(H,18,19)(H,20,21)/t11-,15+/m1/s1 |
| InChIKey | DUVWMAZNZJLLQY-ABAIWWIYSA-N |
| XLogP | 3.02 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|