C18H26N4O3 — CID 51087826
ethyl N-[3-[[1-(1H-benzimidazol-2-yl)-2-methylbutyl]amino]-3-oxopropyl]carbamate (PubChem CID 51087826) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl N-[3-[[1-(1H-benzimidazol-2-yl)-2-methylbutyl]amino]-3-oxopropyl]carbamate.
| Compound Name | ethyl N-[3-[[1-(1H-benzimidazol-2-yl)-2-methylbutyl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 51087826 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | ethyl N-[3-[[1-(1H-benzimidazol-2-yl)-2-methylbutyl]amino]-3-oxopropyl]carbamate |
| SMILES | CCOC(=O)NCCC(=O)NC(c1nc2ccccc2[nH]1)C(C)CC |
| InChI | InChI=1S/C18H26N4O3/c1-4-12(3)16(17-20-13-8-6-7-9-14(13)21-17)22-15(23)10-11-19-18(24)25-5-2/h6-9,12,16H,4-5,10-11H2,1-3H3,(H,19,24)(H,20,21)(H,22,23) |
| InChIKey | RSTXHCSDPKNSQT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |