C19H19Cl2N3O — CID 55862922
N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-2,3-dichlorobenzamide (PubChem CID 55862922) has the molecular formula C19H19Cl2N3O and a molecular weight of 376.29 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-2,3-dichlorobenzamide.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-2,3-dichlorobenzamide |
|---|---|
| PubChem CID | 55862922 |
| Molecular Formula | C19H19Cl2N3O |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)-2-methylbutyl]-2,3-dichlorobenzamide |
| SMILES | CCC(C)C(NC(=O)c1cccc(Cl)c1Cl)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H19Cl2N3O/c1-3-11(2)17(18-22-14-9-4-5-10-15(14)23-18)24-19(25)12-7-6-8-13(20)16(12)21/h4-11,17H,3H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | ONCRTXMEKFUGKC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |