C21H26N2O4S — CID 55814660
(E)-3-[4-(methylsulfamoyl)phenyl]-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)prop-2-enamide (PubChem CID 55814660) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is (E)-3-[4-(methylsulfamoyl)phenyl]-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(methylsulfamoyl)phenyl]-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55814660 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (E)-3-[4-(methylsulfamoyl)phenyl]-N-(2,6,6-trimethyl-5,7-dihydro-4H-1-benzofuran-4-yl)prop-2-enamide |
| SMILES | CNS(=O)(=O)c1ccc(/C=C/C(=O)NC2CC(C)(C)Cc3oc(C)cc32)cc1 |
| InChI | InChI=1S/C21H26N2O4S/c1-14-11-17-18(12-21(2,3)13-19(17)27-14)23-20(24)10-7-15-5-8-16(9-6-15)28(25,26)22-4/h5-11,18,22H,12-13H2,1-4H3,(H,23,24)/b10-7+ |
| InChIKey | ASTLXXOYHRBHQQ-JXMROGBWSA-N |
| XLogP | 3.34 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|