C25H26FN3O3 — CID 55819022
4-[[(4-ethoxyphenyl)methyl-methylcarbamoyl]amino]-N-[(2-fluorophenyl)methyl]benzamide (PubChem CID 55819022) has the molecular formula C25H26FN3O3 and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-[[(4-ethoxyphenyl)methyl-methylcarbamoyl]amino]-N-[(2-fluorophenyl)methyl]benzamide.
| Compound Name | 4-[[(4-ethoxyphenyl)methyl-methylcarbamoyl]amino]-N-[(2-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 55819022 |
| Molecular Formula | C25H26FN3O3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 4-[[(4-ethoxyphenyl)methyl-methylcarbamoyl]amino]-N-[(2-fluorophenyl)methyl]benzamide |
| SMILES | CCOc1ccc(CN(C)C(=O)Nc2ccc(C(=O)NCc3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C25H26FN3O3/c1-3-32-22-14-8-18(9-15-22)17-29(2)25(31)28-21-12-10-19(11-13-21)24(30)27-16-20-6-4-5-7-23(20)26/h4-15H,3,16-17H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | ANWPLNSIYQTBGY-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |