C14H18N4O5S — CID 55819839
4-methoxy-N-[3-(2-methylimidazol-1-yl)propyl]-3-nitrobenzenesulfonamide (PubChem CID 55819839) has the molecular formula C14H18N4O5S and a molecular weight of 354.39 g/mol. Its IUPAC name is 4-methoxy-N-[3-(2-methylimidazol-1-yl)propyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-methoxy-N-[3-(2-methylimidazol-1-yl)propyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55819839 |
| Molecular Formula | C14H18N4O5S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-methoxy-N-[3-(2-methylimidazol-1-yl)propyl]-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCn2ccnc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N4O5S/c1-11-15-7-9-17(11)8-3-6-16-24(21,22)12-4-5-14(23-2)13(10-12)18(19)20/h4-5,7,9-10,16H,3,6,8H2,1-2H3 |
| InChIKey | PPTQJJZGOHDMHV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|