C16H17BrN2O2S2 — CID 55822134
5-bromo-N-[1-oxo-1-(2-thiophen-2-ylpyrrolidin-1-yl)propan-2-yl]thiophene-2-carboxamide (PubChem CID 55822134) has the molecular formula C16H17BrN2O2S2 and a molecular weight of 413.36 g/mol. Its IUPAC name is 5-bromo-N-[1-oxo-1-(2-thiophen-2-ylpyrrolidin-1-yl)propan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[1-oxo-1-(2-thiophen-2-ylpyrrolidin-1-yl)propan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55822134 |
| Molecular Formula | C16H17BrN2O2S2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | 5-bromo-N-[1-oxo-1-(2-thiophen-2-ylpyrrolidin-1-yl)propan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(Br)s1)C(=O)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C16H17BrN2O2S2/c1-10(18-15(20)13-6-7-14(17)23-13)16(21)19-8-2-4-11(19)12-5-3-9-22-12/h3,5-7,9-11H,2,4,8H2,1H3,(H,18,20) |
| InChIKey | PGMVXBBMGNRARS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |