C18H16FN3O5S — CID 55822548
N'-(2-fluorobenzoyl)-1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carbohydrazide (PubChem CID 55822548) has the molecular formula C18H16FN3O5S and a molecular weight of 405.41 g/mol. Its IUPAC name is N'-(2-fluorobenzoyl)-1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carbohydrazide.
| Compound Name | N'-(2-fluorobenzoyl)-1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carbohydrazide |
|---|---|
| PubChem CID | 55822548 |
| Molecular Formula | C18H16FN3O5S |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | N'-(2-fluorobenzoyl)-1,1,3-trioxo-2-propan-2-yl-1,2-benzothiazole-6-carbohydrazide |
| SMILES | CC(C)N1C(=O)c2ccc(C(=O)NNC(=O)c3ccccc3F)cc2S1(=O)=O |
| InChI | InChI=1S/C18H16FN3O5S/c1-10(2)22-18(25)13-8-7-11(9-15(13)28(22,26)27)16(23)20-21-17(24)12-5-3-4-6-14(12)19/h3-10H,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | CYVGAMYQSRUKGH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|