C17H23F3N2O3 — CID 55824930
3-methyl-2-(3-methylbutanoylamino)-N-[3-(trifluoromethoxy)phenyl]butanamide (PubChem CID 55824930) has the molecular formula C17H23F3N2O3 and a molecular weight of 360.38 g/mol. Its IUPAC name is 3-methyl-2-(3-methylbutanoylamino)-N-[3-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | 3-methyl-2-(3-methylbutanoylamino)-N-[3-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 55824930 |
| Molecular Formula | C17H23F3N2O3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 3-methyl-2-(3-methylbutanoylamino)-N-[3-(trifluoromethoxy)phenyl]butanamide |
| SMILES | CC(C)CC(=O)NC(C(=O)Nc1cccc(OC(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C17H23F3N2O3/c1-10(2)8-14(23)22-15(11(3)4)16(24)21-12-6-5-7-13(9-12)25-17(18,19)20/h5-7,9-11,15H,8H2,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | FNUHLPDJJIIWRX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |