C27H27N3O5 — CID 55825530
N-[3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 55825530) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is N-[3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-[3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55825530 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2cccc(NC(=O)C3Cc4ccccc4O3)c2)c1C |
| InChI | InChI=1S/C27H27N3O5/c1-16-8-6-13-22(17(16)2)34-18(3)25(31)29-30-26(32)20-10-7-11-21(14-20)28-27(33)24-15-19-9-4-5-12-23(19)35-24/h4-14,18,24H,15H2,1-3H3,(H,28,33)(H,29,31)(H,30,32) |
| InChIKey | WDFDZGSPRITLLV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|