C23H29N3O5 — CID 55388487
tert-butyl N-[3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]carbamate (PubChem CID 55388487) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 55388487 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | tert-butyl N-[3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]carbamate |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2cccc(NC(=O)OC(C)(C)C)c2)c1C |
| InChI | InChI=1S/C23H29N3O5/c1-14-9-7-12-19(15(14)2)30-16(3)20(27)25-26-21(28)17-10-8-11-18(13-17)24-22(29)31-23(4,5)6/h7-13,16H,1-6H3,(H,24,29)(H,25,27)(H,26,28) |
| InChIKey | OQHJXKUDZRETCX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|