C19H18F4N2O3 — CID 60596269
N'-[2-(2,3-dimethylphenoxy)propanoyl]-4-fluoro-3-(trifluoromethyl)benzohydrazide (PubChem CID 60596269) has the molecular formula C19H18F4N2O3 and a molecular weight of 398.36 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylphenoxy)propanoyl]-4-fluoro-3-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-4-fluoro-3-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 60596269 |
| Molecular Formula | C19H18F4N2O3 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-4-fluoro-3-(trifluoromethyl)benzohydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2ccc(F)c(C(F)(F)F)c2)c1C |
| InChI | InChI=1S/C19H18F4N2O3/c1-10-5-4-6-16(11(10)2)28-12(3)17(26)24-25-18(27)13-7-8-15(20)14(9-13)19(21,22)23/h4-9,12H,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | LWAXMFORJLQVBB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|