C19H20F2N2O4 — CID 43004004
4-(difluoromethoxy)-N'-[2-(2,3-dimethylphenoxy)propanoyl]benzohydrazide (PubChem CID 43004004) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N'-[2-(2,3-dimethylphenoxy)propanoyl]benzohydrazide.
| Compound Name | 4-(difluoromethoxy)-N'-[2-(2,3-dimethylphenoxy)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 43004004 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 4-(difluoromethoxy)-N'-[2-(2,3-dimethylphenoxy)propanoyl]benzohydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2ccc(OC(F)F)cc2)c1C |
| InChI | InChI=1S/C19H20F2N2O4/c1-11-5-4-6-16(12(11)2)26-13(3)17(24)22-23-18(25)14-7-9-15(10-8-14)27-19(20)21/h4-10,13,19H,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | LVCZQIKJDZTSRR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|