C22H24N4O3 — CID 9425399
N'-[(2R)-2-(2,3-dimethylphenoxy)propanoyl]-4-(5-methylpyrazol-1-yl)benzohydrazide (PubChem CID 9425399) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N'-[(2R)-2-(2,3-dimethylphenoxy)propanoyl]-4-(5-methylpyrazol-1-yl)benzohydrazide.
| Compound Name | N'-[(2R)-2-(2,3-dimethylphenoxy)propanoyl]-4-(5-methylpyrazol-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 9425399 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N'-[(2R)-2-(2,3-dimethylphenoxy)propanoyl]-4-(5-methylpyrazol-1-yl)benzohydrazide |
| SMILES | Cc1cccc(O[C@H](C)C(=O)NNC(=O)c2ccc(-n3nccc3C)cc2)c1C |
| InChI | InChI=1S/C22H24N4O3/c1-14-6-5-7-20(16(14)3)29-17(4)21(27)24-25-22(28)18-8-10-19(11-9-18)26-15(2)12-13-23-26/h5-13,17H,1-4H3,(H,24,27)(H,25,28)/t17-/m1/s1 |
| InChIKey | XEWUTQLIVBLJIH-QGZVFWFLSA-N |
| XLogP | 3.03 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|