C23H26N6O6 — CID 55825758
1-[2-[4-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione (PubChem CID 55825758) has the molecular formula C23H26N6O6 and a molecular weight of 482.50 g/mol. Its IUPAC name is 1-[2-[4-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 55825758 |
| Molecular Formula | C23H26N6O6 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 1-[2-[4-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]pyrrolidine-2,5-dione |
| SMILES | Cc1nn(Cc2ccc(C(=O)N3CCN(C(=O)CN4C(=O)CCC4=O)CC3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H26N6O6/c1-15-22(29(34)35)16(2)28(24-15)13-17-3-5-18(6-4-17)23(33)26-11-9-25(10-12-26)21(32)14-27-19(30)7-8-20(27)31/h3-6H,7-14H2,1-2H3 |
| InChIKey | XRIPZYZHAFRIDY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 138.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|