C23H23ClN4O4 — CID 55948018
[2-(4-chlorophenyl)morpholin-4-yl]-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]methanone (PubChem CID 55948018) has the molecular formula C23H23ClN4O4 and a molecular weight of 454.91 g/mol. Its IUPAC name is [2-(4-chlorophenyl)morpholin-4-yl]-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]methanone.
| Compound Name | [2-(4-chlorophenyl)morpholin-4-yl]-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 55948018 |
| Molecular Formula | C23H23ClN4O4 |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [2-(4-chlorophenyl)morpholin-4-yl]-[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]phenyl]methanone |
| SMILES | Cc1nn(Cc2ccc(C(=O)N3CCOC(c4ccc(Cl)cc4)C3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23ClN4O4/c1-15-22(28(30)31)16(2)27(25-15)13-17-3-5-19(6-4-17)23(29)26-11-12-32-21(14-26)18-7-9-20(24)10-8-18/h3-10,21H,11-14H2,1-2H3 |
| InChIKey | ISIFXCBTAPQDPJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|