C21H32N4O4S — CID 55826391
2-[4-[2-(4-acetamidophenyl)sulfanylpropanoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 55826391) has the molecular formula C21H32N4O4S and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[4-[2-(4-acetamidophenyl)sulfanylpropanoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-[2-(4-acetamidophenyl)sulfanylpropanoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 55826391 |
| Molecular Formula | C21H32N4O4S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[4-[2-(4-acetamidophenyl)sulfanylpropanoyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN1CCN(C(=O)C(C)Sc2ccc(NC(C)=O)cc2)CC1 |
| InChI | InChI=1S/C21H32N4O4S/c1-16(30-19-7-5-18(6-8-19)23-17(2)26)21(28)25-12-10-24(11-13-25)15-20(27)22-9-4-14-29-3/h5-8,16H,4,9-15H2,1-3H3,(H,22,27)(H,23,26) |
| InChIKey | UGAKULRNKMDQFZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|