C19H32O4 — CID 558265
(4-propan-2-ylcyclohexyl)methyl 6-propoxy-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 558265) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (4-propan-2-ylcyclohexyl)methyl 6-propoxy-3,6-dihydro-2H-pyran-2-carboxylate.
| Compound Name | (4-propan-2-ylcyclohexyl)methyl 6-propoxy-3,6-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 558265 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (4-propan-2-ylcyclohexyl)methyl 6-propoxy-3,6-dihydro-2H-pyran-2-carboxylate |
| SMILES | CCCOC1C=CCC(C(=O)OCC2CCC(C(C)C)CC2)O1 |
| InChI | InChI=1S/C19H32O4/c1-4-12-21-18-7-5-6-17(23-18)19(20)22-13-15-8-10-16(11-9-15)14(2)3/h5,7,14-18H,4,6,8-13H2,1-3H3 |
| InChIKey | QOWPDAGSAMUSKM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|