C27H44O6 — CID 573847
[3-acetyloxy-6-[4-(4-pentylcyclohexyl)cyclohexyl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 573847) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is [3-acetyloxy-6-[4-(4-pentylcyclohexyl)cyclohexyl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [3-acetyloxy-6-[4-(4-pentylcyclohexyl)cyclohexyl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 573847 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | [3-acetyloxy-6-[4-(4-pentylcyclohexyl)cyclohexyl]oxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CCCCCC1CCC(C2CCC(OC3C=CC(OC(C)=O)C(COC(C)=O)O3)CC2)CC1 |
| InChI | InChI=1S/C27H44O6/c1-4-5-6-7-21-8-10-22(11-9-21)23-12-14-24(15-13-23)32-27-17-16-25(31-20(3)29)26(33-27)18-30-19(2)28/h16-17,21-27H,4-15,18H2,1-3H3 |
| InChIKey | CIKVRUHOANNLQE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|