C20H28O6 — CID 134937257
[(2R,3S)-3-acetyloxy-6-(1-adamantyloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 134937257) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is [(2R,3S)-3-acetyloxy-6-(1-adamantyloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-3-acetyloxy-6-(1-adamantyloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134937257 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [(2R,3S)-3-acetyloxy-6-(1-adamantyloxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC23CC4CC(CC(C4)C2)C3)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H28O6/c1-12(21)23-11-18-17(24-13(2)22)3-4-19(25-18)26-20-8-14-5-15(9-20)7-16(6-14)10-20/h3-4,14-19H,5-11H2,1-2H3/t14?,15?,16?,17-,18+,19?,20?/m0/s1 |
| InChIKey | SEQOFEHVDPBGJB-LQACRIJUSA-N |
| XLogP | 2.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|