C19H30N4O3 — CID 55826786
tert-butyl N-propan-2-yl-N-[[1-(pyrazine-2-carbonyl)piperidin-3-yl]methyl]carbamate (PubChem CID 55826786) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is tert-butyl N-propan-2-yl-N-[[1-(pyrazine-2-carbonyl)piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-propan-2-yl-N-[[1-(pyrazine-2-carbonyl)piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 55826786 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | tert-butyl N-propan-2-yl-N-[[1-(pyrazine-2-carbonyl)piperidin-3-yl]methyl]carbamate |
| SMILES | CC(C)N(CC1CCCN(C(=O)c2cnccn2)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N4O3/c1-14(2)23(18(25)26-19(3,4)5)13-15-7-6-10-22(12-15)17(24)16-11-20-8-9-21-16/h8-9,11,14-15H,6-7,10,12-13H2,1-5H3 |
| InChIKey | WSGVKQYHYDEDFK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |