About tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate
tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate (PubChem CID 55825835) has the molecular formula C23H35BrN2O5
and a molecular weight of 499.45 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate |
| PubChem CID | 55825835 |
| Molecular Formula | C23H35BrN2O5 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate |
| SMILES | COc1cc(C(=O)N2CCCC(CN(C(=O)OC(C)(C)C)C(C)C)C2)cc(OC)c1Br |
| InChI | InChI=1S/C23H35BrN2O5/c1-15(2)26(22(28)31-23(3,4)5)14-16-9-8-10-25(13-16)21(27)17-11-18(29-6)20(24)19(12-17)30-7/h11-12,15-16H,8-10,13-14H2,1-7H3 |
| InChIKey | WEXAHMITBVVPDY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate?
The IUPAC name of tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate (CID 55825835) is tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate.
What is the SMILES notation for tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate?
The canonical SMILES for tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate is COc1cc(C(=O)N2CCCC(CN(C(=O)OC(C)(C)C)C(C)C)C2)cc(OC)c1Br.
What is the InChIKey of tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate?
The InChIKey is WEXAHMITBVVPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35BrN2O5/c1-15(2)26(22(28)31-23(3,4)5)14-16-9-8-10-25(13-16)21(27)17-11-18(29-6)20(24)19(12-17)30-7/h11-12,15-16H,8-10,13-14H2,1-7H3.
What are the key properties of tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate?
tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate has a molecular weight of 499.45 g/mol, XLogP of 4.96, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[1-(4-bromo-3,5-dimethoxybenzoyl)piperidin-3-yl]methyl]-N-propan-2-ylcarbamate is sourced from PubChem (CID 55825835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).