C20H21FN4O4 — CID 55827007
(2-amino-5-fluoro-3-nitrophenyl)-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]methanone (PubChem CID 55827007) has the molecular formula C20H21FN4O4 and a molecular weight of 400.41 g/mol. Its IUPAC name is (2-amino-5-fluoro-3-nitrophenyl)-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (2-amino-5-fluoro-3-nitrophenyl)-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55827007 |
| Molecular Formula | C20H21FN4O4 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2-amino-5-fluoro-3-nitrophenyl)-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazin-1-yl]methanone |
| SMILES | Nc1c(C(=O)N2CCN(Cc3ccc4c(c3)CCO4)CC2)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21FN4O4/c21-15-10-16(19(22)17(11-15)25(27)28)20(26)24-6-4-23(5-7-24)12-13-1-2-18-14(9-13)3-8-29-18/h1-2,9-11H,3-8,12,22H2 |
| InChIKey | AHYXQDNCUFAXPF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|