C22H23N3O6 — CID 46655845
methyl 3-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1-carbonyl]-5-nitrobenzoate (PubChem CID 46655845) has the molecular formula C22H23N3O6 and a molecular weight of 425.44 g/mol. Its IUPAC name is methyl 3-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1-carbonyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1-carbonyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 46655845 |
| Molecular Formula | C22H23N3O6 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | methyl 3-[4-(2,3-dihydro-1-benzofuran-5-ylmethyl)piperazine-1-carbonyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)N2CCN(Cc3ccc4c(c3)CCO4)CC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H23N3O6/c1-30-22(27)18-11-17(12-19(13-18)25(28)29)21(26)24-7-5-23(6-8-24)14-15-2-3-20-16(10-15)4-9-31-20/h2-3,10-13H,4-9,14H2,1H3 |
| InChIKey | WJLPZOUYGWQWPL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|