C21H22ClN3O5 — CID 55473773
methyl 3-[4-[(4-chlorophenyl)methyl]-1,4-diazepane-1-carbonyl]-5-nitrobenzoate (PubChem CID 55473773) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is methyl 3-[4-[(4-chlorophenyl)methyl]-1,4-diazepane-1-carbonyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[4-[(4-chlorophenyl)methyl]-1,4-diazepane-1-carbonyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 55473773 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | methyl 3-[4-[(4-chlorophenyl)methyl]-1,4-diazepane-1-carbonyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)N2CCCN(Cc3ccc(Cl)cc3)CC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H22ClN3O5/c1-30-21(27)17-11-16(12-19(13-17)25(28)29)20(26)24-8-2-7-23(9-10-24)14-15-3-5-18(22)6-4-15/h3-6,11-13H,2,7-10,14H2,1H3 |
| InChIKey | PIDQBFHNFGMUCD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|