C23H26N2O5 — CID 24567040
methyl 3-[4-[2-(4-methylphenyl)ethyl]piperidine-1-carbonyl]-5-nitrobenzoate (PubChem CID 24567040) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is methyl 3-[4-[2-(4-methylphenyl)ethyl]piperidine-1-carbonyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[4-[2-(4-methylphenyl)ethyl]piperidine-1-carbonyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 24567040 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | methyl 3-[4-[2-(4-methylphenyl)ethyl]piperidine-1-carbonyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)N2CCC(CCc3ccc(C)cc3)CC2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H26N2O5/c1-16-3-5-17(6-4-16)7-8-18-9-11-24(12-10-18)22(26)19-13-20(23(27)30-2)15-21(14-19)25(28)29/h3-6,13-15,18H,7-12H2,1-2H3 |
| InChIKey | XFEKKPCVAUQDNZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|