C22H24N4O3 — CID 55831296
4-methyl-3-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-5-nitrobenzonitrile (PubChem CID 55831296) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-methyl-3-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-5-nitrobenzonitrile.
| Compound Name | 4-methyl-3-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 55831296 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 4-methyl-3-[4-(2-methyl-2-phenylpropanoyl)piperazin-1-yl]-5-nitrobenzonitrile |
| SMILES | Cc1c(N2CCN(C(=O)C(C)(C)c3ccccc3)CC2)cc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N4O3/c1-16-19(13-17(15-23)14-20(16)26(28)29)24-9-11-25(12-10-24)21(27)22(2,3)18-7-5-4-6-8-18/h4-8,13-14H,9-12H2,1-3H3 |
| InChIKey | VQUBBBMGCNZLPL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|