C26H35N5O3 — CID 55831378
2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide (PubChem CID 55831378) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide.
| Compound Name | 2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 55831378 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]-N-[(1-phenylpyrrolidin-3-yl)methyl]acetamide |
| SMILES | CN(CC(=O)NCC1CCN(c2ccccc2)C1)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H35N5O3/c1-29(19-25(32)27-17-21-11-12-31(18-21)23-5-3-2-4-6-23)20-26(33)28-22-7-9-24(10-8-22)30-13-15-34-16-14-30/h2-10,21H,11-20H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | WVLVKKUBXDLEEC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|