C22H30N4O3 — CID 55832039
methyl 4-[2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]ethoxy]benzoate (PubChem CID 55832039) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is methyl 4-[2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 55832039 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | methyl 4-[2-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCN2CCN(c3cc(C)nc(C(C)C)n3)CC2)cc1 |
| InChI | InChI=1S/C22H30N4O3/c1-16(2)21-23-17(3)15-20(24-21)26-11-9-25(10-12-26)13-14-29-19-7-5-18(6-8-19)22(27)28-4/h5-8,15-16H,9-14H2,1-4H3 |
| InChIKey | LBIMTGRZYXROEI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |