C21H25N3O4 — CID 55833777
1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea (PubChem CID 55833777) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 55833777 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[2-(morpholin-4-ylmethyl)phenyl]urea |
| SMILES | CC(NC(=O)Nc1ccccc1CN1CCOCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H25N3O4/c1-15(16-6-7-19-20(12-16)28-14-27-19)22-21(25)23-18-5-3-2-4-17(18)13-24-8-10-26-11-9-24/h2-7,12,15H,8-11,13-14H2,1H3,(H2,22,23,25) |
| InChIKey | SAXAENWZUMIHCH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |