C21H28N4O4 — CID 55834300
1-tert-butyl-5-cyclopropyl-N'-[2-(2-ethoxyphenoxy)acetyl]pyrazole-3-carbohydrazide (PubChem CID 55834300) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-tert-butyl-5-cyclopropyl-N'-[2-(2-ethoxyphenoxy)acetyl]pyrazole-3-carbohydrazide.
| Compound Name | 1-tert-butyl-5-cyclopropyl-N'-[2-(2-ethoxyphenoxy)acetyl]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 55834300 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-tert-butyl-5-cyclopropyl-N'-[2-(2-ethoxyphenoxy)acetyl]pyrazole-3-carbohydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)c1cc(C2CC2)n(C(C)(C)C)n1 |
| InChI | InChI=1S/C21H28N4O4/c1-5-28-17-8-6-7-9-18(17)29-13-19(26)22-23-20(27)15-12-16(14-10-11-14)25(24-15)21(2,3)4/h6-9,12,14H,5,10-11,13H2,1-4H3,(H,22,26)(H,23,27) |
| InChIKey | AEXYZWWSIYKFIZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|