C20H21F3N6OS — CID 55834515
3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]propanamide (PubChem CID 55834515) has the molecular formula C20H21F3N6OS and a molecular weight of 450.49 g/mol. Its IUPAC name is 3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]propanamide.
| Compound Name | 3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 55834515 |
| Molecular Formula | C20H21F3N6OS |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]propanamide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CCC(=O)NCCNc2ncccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N6OS/c1-13-4-2-5-14(12-13)18-27-28-19(31)29(18)11-7-16(30)24-9-10-26-17-15(20(21,22)23)6-3-8-25-17/h2-6,8,12H,7,9-11H2,1H3,(H,24,30)(H,25,26)(H,28,31) |
| InChIKey | RLFFDGWGYORIJV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|