C25H22FN3O4S — CID 55834771
N-[2-(3-ethynylanilino)-2-oxoethyl]-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 55834771) has the molecular formula C25H22FN3O4S and a molecular weight of 479.53 g/mol. Its IUPAC name is N-[2-(3-ethynylanilino)-2-oxoethyl]-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 55834771 |
| Molecular Formula | C25H22FN3O4S |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)C(Cc2ccccc2)NS(=O)(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C25H22FN3O4S/c1-2-18-11-8-12-20(15-18)28-24(30)17-27-25(31)22(16-19-9-4-3-5-10-19)29-34(32,33)23-14-7-6-13-21(23)26/h1,3-15,22,29H,16-17H2,(H,27,31)(H,28,30) |
| InChIKey | NZCNNSFGCQSBIG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|