C24H25FN2O3S — CID 18224680
2-[(2-fluorophenyl)sulfonylamino]-3-phenyl-N-(3-propan-2-ylphenyl)propanamide (PubChem CID 18224680) has the molecular formula C24H25FN2O3S and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)sulfonylamino]-3-phenyl-N-(3-propan-2-ylphenyl)propanamide.
| Compound Name | 2-[(2-fluorophenyl)sulfonylamino]-3-phenyl-N-(3-propan-2-ylphenyl)propanamide |
|---|---|
| PubChem CID | 18224680 |
| Molecular Formula | C24H25FN2O3S |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[(2-fluorophenyl)sulfonylamino]-3-phenyl-N-(3-propan-2-ylphenyl)propanamide |
| SMILES | CC(C)c1cccc(NC(=O)C(Cc2ccccc2)NS(=O)(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C24H25FN2O3S/c1-17(2)19-11-8-12-20(16-19)26-24(28)22(15-18-9-4-3-5-10-18)27-31(29,30)23-14-7-6-13-21(23)25/h3-14,16-17,22,27H,15H2,1-2H3,(H,26,28) |
| InChIKey | MFWFCSLBGUJPBN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |