C21H18ClFN2O4S — CID 56581236
N-(5-chloro-2-hydroxyphenyl)-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 56581236) has the molecular formula C21H18ClFN2O4S and a molecular weight of 448.90 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 56581236 |
| Molecular Formula | C21H18ClFN2O4S |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-2-[(2-fluorophenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | O=C(Nc1cc(Cl)ccc1O)C(Cc1ccccc1)NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C21H18ClFN2O4S/c22-15-10-11-19(26)17(13-15)24-21(27)18(12-14-6-2-1-3-7-14)25-30(28,29)20-9-5-4-8-16(20)23/h1-11,13,18,25-26H,12H2,(H,24,27) |
| InChIKey | OXXFVTVSWHYCHB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|