C20H21ClN2O4 — CID 55835897
2-chloro-5-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]-N-methylbenzamide (PubChem CID 55835897) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is 2-chloro-5-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]-N-methylbenzamide.
| Compound Name | 2-chloro-5-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 55835897 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-chloro-5-[[4-(4-ethoxyphenyl)-4-oxobutanoyl]amino]-N-methylbenzamide |
| SMILES | CCOc1ccc(C(=O)CCC(=O)Nc2ccc(Cl)c(C(=O)NC)c2)cc1 |
| InChI | InChI=1S/C20H21ClN2O4/c1-3-27-15-7-4-13(5-8-15)18(24)10-11-19(25)23-14-6-9-17(21)16(12-14)20(26)22-2/h4-9,12H,3,10-11H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | DTDZGVQFTPFKOF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |