C24H27N5O2 — CID 55836456
N-cyclopentyl-4-[[2-(pyrazol-1-ylmethyl)phenyl]methylcarbamoylamino]benzamide (PubChem CID 55836456) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-cyclopentyl-4-[[2-(pyrazol-1-ylmethyl)phenyl]methylcarbamoylamino]benzamide.
| Compound Name | N-cyclopentyl-4-[[2-(pyrazol-1-ylmethyl)phenyl]methylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 55836456 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-cyclopentyl-4-[[2-(pyrazol-1-ylmethyl)phenyl]methylcarbamoylamino]benzamide |
| SMILES | O=C(NCc1ccccc1Cn1cccn1)Nc1ccc(C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C24H27N5O2/c30-23(27-21-8-3-4-9-21)18-10-12-22(13-11-18)28-24(31)25-16-19-6-1-2-7-20(19)17-29-15-5-14-26-29/h1-2,5-7,10-15,21H,3-4,8-9,16-17H2,(H,27,30)(H2,25,28,31) |
| InChIKey | UHPQTXUSGAQMDE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |