C18H16F2N4O — CID 51290797
1-(3,4-difluorophenyl)-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]urea (PubChem CID 51290797) has the molecular formula C18H16F2N4O and a molecular weight of 342.35 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 51290797 |
| Molecular Formula | C18H16F2N4O |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1Cn1cccn1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H16F2N4O/c19-16-7-6-15(10-17(16)20)23-18(25)21-11-13-4-1-2-5-14(13)12-24-9-3-8-22-24/h1-10H,11-12H2,(H2,21,23,25) |
| InChIKey | NCIPMFVKWNPITL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |