C21H21N7O — CID 166209972
1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea (PubChem CID 166209972) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea.
| Compound Name | 1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 166209972 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea |
| SMILES | O=C(NCc1ccccc1Cn1cccn1)Nc1ccn(Cc2ccncc2)n1 |
| InChI | InChI=1S/C21H21N7O/c29-21(25-20-8-13-28(26-20)15-17-6-10-22-11-7-17)23-14-18-4-1-2-5-19(18)16-27-12-3-9-24-27/h1-13H,14-16H2,(H2,23,25,26,29) |
| InChIKey | PVXUUUHWUDAAIU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |