C16H13Cl2N5O — CID 51130131
1-(2,5-dichlorophenyl)-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea (PubChem CID 51130131) has the molecular formula C16H13Cl2N5O and a molecular weight of 362.22 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 51130131 |
| Molecular Formula | C16H13Cl2N5O |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-[1-(pyridin-4-ylmethyl)pyrazol-3-yl]urea |
| SMILES | O=C(Nc1ccn(Cc2ccncc2)n1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H13Cl2N5O/c17-12-1-2-13(18)14(9-12)20-16(24)21-15-5-8-23(22-15)10-11-3-6-19-7-4-11/h1-9H,10H2,(H2,20,21,22,24) |
| InChIKey | CUBZSPBLSBQJCN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |