C19H18F2N4O2 — CID 55738450
1-[3-(difluoromethoxy)phenyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]urea (PubChem CID 55738450) has the molecular formula C19H18F2N4O2 and a molecular weight of 372.38 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]urea.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55738450 |
| Molecular Formula | C19H18F2N4O2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1Cn1cccn1)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C19H18F2N4O2/c20-18(21)27-17-8-3-7-16(11-17)24-19(26)22-12-14-5-1-2-6-15(14)13-25-10-4-9-23-25/h1-11,18H,12-13H2,(H2,22,24,26) |
| InChIKey | AREUJUXDEUMALR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |