C23H19N5O4 — CID 55837618
N-[1-(3-benzamidophenyl)ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 55837618) has the molecular formula C23H19N5O4 and a molecular weight of 429.44 g/mol. Its IUPAC name is N-[1-(3-benzamidophenyl)ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[1-(3-benzamidophenyl)ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 55837618 |
| Molecular Formula | C23H19N5O4 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | N-[1-(3-benzamidophenyl)ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CC(NC(=O)c1cnc2[nH]c(=O)[nH]c(=O)c2c1)c1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H19N5O4/c1-13(15-8-5-9-17(10-15)26-20(29)14-6-3-2-4-7-14)25-21(30)16-11-18-19(24-12-16)27-23(32)28-22(18)31/h2-13H,1H3,(H,25,30)(H,26,29)(H2,24,27,28,31,32) |
| InChIKey | NUOPQHXRRKBPLQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |