C17H20N2O4 — CID 55838452
methyl 2-methyl-3-[methyl-[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]propanoate (PubChem CID 55838452) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 2-methyl-3-[methyl-[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]propanoate.
| Compound Name | methyl 2-methyl-3-[methyl-[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 55838452 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | methyl 2-methyl-3-[methyl-[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]propanoate |
| SMILES | C=C1c2ccccc2C(=O)N1CC(=O)N(C)CC(C)C(=O)OC |
| InChI | InChI=1S/C17H20N2O4/c1-11(17(22)23-4)9-18(3)15(20)10-19-12(2)13-7-5-6-8-14(13)16(19)21/h5-8,11H,2,9-10H2,1,3-4H3 |
| InChIKey | FHLUFZNMLNIHFM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |