C16H21N3O3 — CID 119655397
N-(3-amino-2,2-dimethylpropyl)-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide (PubChem CID 119655397) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 119655397 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-2-(1,3-dioxoisoindol-2-yl)-N-methylacetamide |
| SMILES | CN(CC(C)(C)CN)C(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H21N3O3/c1-16(2,9-17)10-18(3)13(20)8-19-14(21)11-6-4-5-7-12(11)15(19)22/h4-7H,8-10,17H2,1-3H3 |
| InChIKey | FQTJQCKYOXZDIA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|