C14H26N4O3 — CID 119655735
N-(3-amino-2,2-dimethylpropyl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-methylacetamide (PubChem CID 119655735) has the molecular formula C14H26N4O3 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-methylacetamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 119655735 |
| Molecular Formula | C14H26N4O3 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-methylacetamide |
| SMILES | CCN1CCN(CC(=O)N(C)CC(C)(C)CN)C(=O)C1=O |
| InChI | InChI=1S/C14H26N4O3/c1-5-17-6-7-18(13(21)12(17)20)8-11(19)16(4)10-14(2,3)9-15/h5-10,15H2,1-4H3 |
| InChIKey | LZVPSLSHWMUBCO-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|